C15H22N4O3 — CID 78787526
N'-[2-[4-(2-hydroxyethyl)piperazin-1-yl]acetyl]benzohydrazide (PubChem CID 78787526) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is N'-[2-[4-(2-hydroxyethyl)piperazin-1-yl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[4-(2-hydroxyethyl)piperazin-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 78787526 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N'-[2-[4-(2-hydroxyethyl)piperazin-1-yl]acetyl]benzohydrazide |
| SMILES | O=C(CN1CCN(CCO)CC1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22N4O3/c20-11-10-18-6-8-19(9-7-18)12-14(21)16-17-15(22)13-4-2-1-3-5-13/h1-5,20H,6-12H2,(H,16,21)(H,17,22) |
| InChIKey | GASWKDMHDKGLLT-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|