C24H37ClN4O3Si — CID 170746704
tert-butyl 3-[4-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 170746704) has the molecular formula C24H37ClN4O3Si and a molecular weight of 493.12 g/mol. Its IUPAC name is tert-butyl 3-[4-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[4-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 170746704 |
| Molecular Formula | C24H37ClN4O3Si |
| Molecular Weight | 493.12 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | tert-butyl 3-[4-chloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(c1cn(COCC[Si](C)(C)C)c3ncnc(Cl)c13)C2 |
| InChI | InChI=1S/C24H37ClN4O3Si/c1-24(2,3)32-23(30)29-17-7-8-18(29)12-16(11-17)19-13-28(15-31-9-10-33(4,5)6)22-20(19)21(25)26-14-27-22/h13-14,16-18H,7-12,15H2,1-6H3 |
| InChIKey | FYZDMFKISSMURV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.12 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|