C29H47N3O5Si — CID 177243257
tert-butyl (2R,3R)-2-methyl-3-[3-(2-methyloxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxypyrrolidine-1-carboxylate (PubChem CID 177243257) has the molecular formula C29H47N3O5Si and a molecular weight of 545.80 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-methyl-3-[3-(2-methyloxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-2-methyl-3-[3-(2-methyloxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177243257 |
| Molecular Formula | C29H47N3O5Si |
| Molecular Weight | 545.80 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | tert-butyl (2R,3R)-2-methyl-3-[3-(2-methyloxan-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxypyrrolidine-1-carboxylate |
| SMILES | CC1CC(c2cn(COCC[Si](C)(C)C)c3nccc(O[C@@H]4CCN(C(=O)OC(C)(C)C)[C@@H]4C)c23)CCO1 |
| InChI | InChI=1S/C29H47N3O5Si/c1-20-17-22(11-14-35-20)23-18-31(19-34-15-16-38(6,7)8)27-26(23)25(9-12-30-27)36-24-10-13-32(21(24)2)28(33)37-29(3,4)5/h9,12,18,20-22,24H,10-11,13-17,19H2,1-8H3/t20?,21-,22?,24-/m1/s1 |
| InChIKey | CAHMBSUGKAPBCY-RBWAZQEJSA-N |
| XLogP | 6.41 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.80 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|