C18H33N3O4Si — CID 171592803
tert-butyl (2R)-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]oxymethyl]azetidine-1-carboxylate (PubChem CID 171592803) has the molecular formula C18H33N3O4Si and a molecular weight of 383.57 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 171592803 |
| Molecular Formula | C18H33N3O4Si |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | tert-butyl (2R)-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]oxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]1COc1cnn(COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C18H33N3O4Si/c1-18(2,3)25-17(22)21-8-7-15(21)13-24-16-11-19-20(12-16)14-23-9-10-26(4,5)6/h11-12,15H,7-10,13-14H2,1-6H3/t15-/m1/s1 |
| InChIKey | HQKKBOMFBIYGPV-OAHLLOKOSA-N |
| XLogP | 3.58 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|