C15H20F2N2O3 — CID 21345219
tert-butyl (2S)-2-[[6-(difluoromethyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate (PubChem CID 21345219) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[6-(difluoromethyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[6-(difluoromethyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 21345219 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | tert-butyl (2S)-2-[[6-(difluoromethyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1COc1ccc(C(F)F)nc1 |
| InChI | InChI=1S/C15H20F2N2O3/c1-15(2,3)22-14(20)19-7-6-10(19)9-21-11-4-5-12(13(16)17)18-8-11/h4-5,8,10,13H,6-7,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | FDKHKAXGPIEHGH-JTQLQIEISA-N |
| XLogP | 3.41 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |