C25H45N5O3Si — CID 167459931
tert-butyl (1R,4R)-5-[[1-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]piperidin-4-yl]methyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 167459931) has the molecular formula C25H45N5O3Si and a molecular weight of 491.75 g/mol. Its IUPAC name is tert-butyl (1R,4R)-5-[[1-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]piperidin-4-yl]methyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,4R)-5-[[1-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]piperidin-4-yl]methyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 167459931 |
| Molecular Formula | C25H45N5O3Si |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 491.33 |
| IUPAC Name | tert-butyl (1R,4R)-5-[[1-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]piperidin-4-yl]methyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1CN2CC1CCN(c2cnn(COCC[Si](C)(C)C)c2)CC1 |
| InChI | InChI=1S/C25H45N5O3Si/c1-25(2,3)33-24(31)30-18-21-13-22(30)16-28(21)15-20-7-9-27(10-8-20)23-14-26-29(17-23)19-32-11-12-34(4,5)6/h14,17,20-22H,7-13,15-16,18-19H2,1-6H3/t21-,22-/m1/s1 |
| InChIKey | BVGLQQYVRIDWQT-FGZHOGPDSA-N |
| XLogP | 4.11 |
| TPSA | 63.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|