C14H27N3O2Si — CID 175146402
trans-(1R,2R)-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]amino]cyclopentan-1-ol (PubChem CID 175146402) has the molecular formula C14H27N3O2Si and a molecular weight of 297.48 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]amino]cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 175146402 |
| Molecular Formula | C14H27N3O2Si |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | trans-(1R,2R)-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]amino]cyclopentan-1-ol |
| SMILES | C[Si](C)(C)CCOCn1cc(N[C@@H]2CCC[C@H]2O)cn1 |
| InChI | InChI=1S/C14H27N3O2Si/c1-20(2,3)8-7-19-11-17-10-12(9-15-17)16-13-5-4-6-14(13)18/h9-10,13-14,16,18H,4-8,11H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | IGPBZXFWZICVEZ-ZIAGYGMSSA-N |
| XLogP | 2.52 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|