C12H21N3 — CID 93112285
1-ethyl-N-[(1S,2R)-2-methylcyclohexyl]pyrazol-4-amine (PubChem CID 93112285) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-ethyl-N-[(1S,2R)-2-methylcyclohexyl]pyrazol-4-amine.
| Compound Name | 1-ethyl-N-[(1S,2R)-2-methylcyclohexyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 93112285 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 1-ethyl-N-[(1S,2R)-2-methylcyclohexyl]pyrazol-4-amine |
| SMILES | CCn1cc(N[C@H]2CCCC[C@H]2C)cn1 |
| InChI | InChI=1S/C12H21N3/c1-3-15-9-11(8-13-15)14-12-7-5-4-6-10(12)2/h8-10,12,14H,3-7H2,1-2H3/t10-,12+/m1/s1 |
| InChIKey | MRJVTWFCBUVPQS-PWSUYJOCSA-N |
| XLogP | 2.89 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |