C7H13N3 — CID 43543394
N,1-diethylpyrazol-4-amine (PubChem CID 43543394) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is N,1-diethylpyrazol-4-amine.
| Compound Name | N,1-diethylpyrazol-4-amine |
|---|---|
| PubChem CID | 43543394 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N,1-diethylpyrazol-4-amine |
| SMILES | CCNc1cnn(CC)c1 |
| InChI | InChI=1S/C7H13N3/c1-3-8-7-5-9-10(4-2)6-7/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | UNGMQQGBHGRENQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |