C6H10N4S — CID 43543607
(1-ethylpyrazol-4-yl)thiourea (PubChem CID 43543607) has the molecular formula C6H10N4S and a molecular weight of 170.24 g/mol. Its IUPAC name is (1-ethylpyrazol-4-yl)thiourea.
| Compound Name | (1-ethylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 43543607 |
| Molecular Formula | C6H10N4S |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (1-ethylpyrazol-4-yl)thiourea |
| SMILES | CCn1cc(NC(N)=S)cn1 |
| InChI | InChI=1S/C6H10N4S/c1-2-10-4-5(3-8-10)9-6(7)11/h3-4H,2H2,1H3,(H3,7,9,11) |
| InChIKey | FNWMQIZBZYHMDS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|