C16H21BrClN3O2Si — CID 171575075
3-bromo-5-chloro-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]amino]benzaldehyde (PubChem CID 171575075) has the molecular formula C16H21BrClN3O2Si and a molecular weight of 430.81 g/mol. Its IUPAC name is 3-bromo-5-chloro-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]amino]benzaldehyde.
| Compound Name | 3-bromo-5-chloro-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]amino]benzaldehyde |
|---|---|
| PubChem CID | 171575075 |
| Molecular Formula | C16H21BrClN3O2Si |
| Molecular Weight | 430.81 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 3-bromo-5-chloro-2-[[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]amino]benzaldehyde |
| SMILES | C[Si](C)(C)CCOCn1cc(Nc2c(Br)cc(Cl)cc2C=O)cn1 |
| InChI | InChI=1S/C16H21BrClN3O2Si/c1-24(2,3)5-4-23-11-21-9-14(8-19-21)20-16-12(10-22)6-13(18)7-15(16)17/h6-10,20H,4-5,11H2,1-3H3 |
| InChIKey | KWSOJENNJTVFEN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.81 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|