C14H19BrClNOSi — CID 140807311
2-[(4-bromo-6-chloroindol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 140807311) has the molecular formula C14H19BrClNOSi and a molecular weight of 360.76 g/mol. Its IUPAC name is 2-[(4-bromo-6-chloroindol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4-bromo-6-chloroindol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140807311 |
| Molecular Formula | C14H19BrClNOSi |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 2-[(4-bromo-6-chloroindol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Br)cc(Cl)cc21 |
| InChI | InChI=1S/C14H19BrClNOSi/c1-19(2,3)7-6-18-10-17-5-4-12-13(15)8-11(16)9-14(12)17/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | GYAWMGYTSJPJAB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|