C15H19Br2NO2Si — CID 140829624
4,6-dibromo-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one (PubChem CID 140829624) has the molecular formula C15H19Br2NO2Si and a molecular weight of 433.22 g/mol. Its IUPAC name is 4,6-dibromo-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one.
| Compound Name | 4,6-dibromo-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 140829624 |
| Molecular Formula | C15H19Br2NO2Si |
| Molecular Weight | 433.22 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | 4,6-dibromo-2-(2-trimethylsilylethoxymethyl)isoquinolin-1-one |
| SMILES | C[Si](C)(C)CCOCn1cc(Br)c2cc(Br)ccc2c1=O |
| InChI | InChI=1S/C15H19Br2NO2Si/c1-21(2,3)7-6-20-10-18-9-14(17)13-8-11(16)4-5-12(13)15(18)19/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | GQUMBCUPZBECDF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.22 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|