C15H18BrFN2OSi — CID 167375991
2-[(3-bromo-5-fluoro-6-isocyanoindol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 167375991) has the molecular formula C15H18BrFN2OSi and a molecular weight of 369.31 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluoro-6-isocyanoindol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(3-bromo-5-fluoro-6-isocyanoindol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 167375991 |
| Molecular Formula | C15H18BrFN2OSi |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2-[(3-bromo-5-fluoro-6-isocyanoindol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | [C-]#[N+]c1cc2c(cc1F)c(Br)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C15H18BrFN2OSi/c1-18-14-8-15-11(7-13(14)17)12(16)9-19(15)10-20-5-6-21(2,3)4/h7-9H,5-6,10H2,2-4H3 |
| InChIKey | LYFDDAPKKHJVFX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 18.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|