C21H23BrCl2FNO2Si — CID 67280301
2-[[5-bromo-4-chloro-3-(4-chloro-5-fluoro-2-methoxyphenyl)indol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 67280301) has the molecular formula C21H23BrCl2FNO2Si and a molecular weight of 519.31 g/mol. Its IUPAC name is 2-[[5-bromo-4-chloro-3-(4-chloro-5-fluoro-2-methoxyphenyl)indol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-bromo-4-chloro-3-(4-chloro-5-fluoro-2-methoxyphenyl)indol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 67280301 |
| Molecular Formula | C21H23BrCl2FNO2Si |
| Molecular Weight | 519.31 g/mol |
| Exact Mass | 517.00 |
| IUPAC Name | 2-[[5-bromo-4-chloro-3-(4-chloro-5-fluoro-2-methoxyphenyl)indol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc(Cl)c(F)cc1-c1cn(COCC[Si](C)(C)C)c2ccc(Br)c(Cl)c12 |
| InChI | InChI=1S/C21H23BrCl2FNO2Si/c1-27-19-10-16(23)17(25)9-13(19)14-11-26(12-28-7-8-29(2,3)4)18-6-5-15(22)21(24)20(14)18/h5-6,9-11H,7-8,12H2,1-4H3 |
| InChIKey | AUBDLRVDUVWNDR-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.31 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|