C24H23BrClF2N3OSi — CID 150732144
2-[[5-(3-bromoquinolin-6-yl)-4-(5-chloro-2,4-difluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 150732144) has the molecular formula C24H23BrClF2N3OSi and a molecular weight of 550.91 g/mol. Its IUPAC name is 2-[[5-(3-bromoquinolin-6-yl)-4-(5-chloro-2,4-difluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(3-bromoquinolin-6-yl)-4-(5-chloro-2,4-difluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 150732144 |
| Molecular Formula | C24H23BrClF2N3OSi |
| Molecular Weight | 550.91 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | 2-[[5-(3-bromoquinolin-6-yl)-4-(5-chloro-2,4-difluorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cnc(-c2cc(Cl)c(F)cc2F)c1-c1ccc2ncc(Br)cc2c1 |
| InChI | InChI=1S/C24H23BrClF2N3OSi/c1-33(2,3)7-6-32-14-31-13-30-23(18-10-19(26)21(28)11-20(18)27)24(31)15-4-5-22-16(8-15)9-17(25)12-29-22/h4-5,8-13H,6-7,14H2,1-3H3 |
| InChIKey | JSBCJJZDPWCAOC-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.91 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|