C27H30N6OSi — CID 156686536
trimethyl-[2-[[5-(6-methyl-2-pyridinyl)-4-[3-(1H-pyrazol-4-yl)quinolin-6-yl]imidazol-1-yl]methoxy]ethyl]silane (PubChem CID 156686536) has the molecular formula C27H30N6OSi and a molecular weight of 482.66 g/mol. Its IUPAC name is trimethyl-[2-[[5-(6-methyl-2-pyridinyl)-4-[3-(1H-pyrazol-4-yl)quinolin-6-yl]imidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-(6-methyl-2-pyridinyl)-4-[3-(1H-pyrazol-4-yl)quinolin-6-yl]imidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 156686536 |
| Molecular Formula | C27H30N6OSi |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | trimethyl-[2-[[5-(6-methyl-2-pyridinyl)-4-[3-(1H-pyrazol-4-yl)quinolin-6-yl]imidazol-1-yl]methoxy]ethyl]silane |
| SMILES | Cc1cccc(-c2c(-c3ccc4ncc(-c5cn[nH]c5)cc4c3)ncn2COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C27H30N6OSi/c1-19-6-5-7-25(32-19)27-26(29-17-33(27)18-34-10-11-35(2,3)4)20-8-9-24-21(12-20)13-22(14-28-24)23-15-30-31-16-23/h5-9,12-17H,10-11,18H2,1-4H3,(H,30,31) |
| InChIKey | NWZAKFFFDYIOFR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|