C13H21N3OSi — CID 141189277
trimethyl-[2-[[3-(1H-pyrazol-4-yl)pyrrol-1-yl]methoxy]ethyl]silane (PubChem CID 141189277) has the molecular formula C13H21N3OSi and a molecular weight of 263.42 g/mol. Its IUPAC name is trimethyl-[2-[[3-(1H-pyrazol-4-yl)pyrrol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[3-(1H-pyrazol-4-yl)pyrrol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 141189277 |
| Molecular Formula | C13H21N3OSi |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | trimethyl-[2-[[3-(1H-pyrazol-4-yl)pyrrol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ccc(-c2cn[nH]c2)c1 |
| InChI | InChI=1S/C13H21N3OSi/c1-18(2,3)7-6-17-11-16-5-4-12(10-16)13-8-14-15-9-13/h4-5,8-10H,6-7,11H2,1-3H3,(H,14,15) |
| InChIKey | NSPVPXYJTLBBHC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|