C17H22FNO2Si — CID 140735529
3-(4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyridin-4-one (PubChem CID 140735529) has the molecular formula C17H22FNO2Si and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyridin-4-one.
| Compound Name | 3-(4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyridin-4-one |
|---|---|
| PubChem CID | 140735529 |
| Molecular Formula | C17H22FNO2Si |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyridin-4-one |
| SMILES | C[Si](C)(C)CCOCn1ccc(=O)c(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H22FNO2Si/c1-22(2,3)11-10-21-13-19-9-8-17(20)16(12-19)14-4-6-15(18)7-5-14/h4-9,12H,10-11,13H2,1-3H3 |
| InChIKey | CTGLGKWAPZEMGB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|