C21H25FN2O3Si — CID 90258343
6-(4-fluorophenyl)-8-methoxy-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one (PubChem CID 90258343) has the molecular formula C21H25FN2O3Si and a molecular weight of 400.53 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-8-methoxy-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one.
| Compound Name | 6-(4-fluorophenyl)-8-methoxy-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 90258343 |
| Molecular Formula | C21H25FN2O3Si |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 6-(4-fluorophenyl)-8-methoxy-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
| SMILES | COc1cc(-c2ccc(F)cc2)cc2c(=O)n(COCC[Si](C)(C)C)cnc12 |
| InChI | InChI=1S/C21H25FN2O3Si/c1-26-19-12-16(15-5-7-17(22)8-6-15)11-18-20(19)23-13-24(21(18)25)14-27-9-10-28(2,3)4/h5-8,11-13H,9-10,14H2,1-4H3 |
| InChIKey | RMUCOKQKFZLLHF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|