C28H39N5O4Si2 — CID 90257734
6-[2-(1H-imidazol-2-yl)-3-pyridinyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one (PubChem CID 90257734) has the molecular formula C28H39N5O4Si2 and a molecular weight of 565.82 g/mol. Its IUPAC name is 6-[2-(1H-imidazol-2-yl)-3-pyridinyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one.
| Compound Name | 6-[2-(1H-imidazol-2-yl)-3-pyridinyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 90257734 |
| Molecular Formula | C28H39N5O4Si2 |
| Molecular Weight | 565.82 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | 6-[2-(1H-imidazol-2-yl)-3-pyridinyl]-8-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
| SMILES | C[Si](C)(C)CCOCOc1cc(-c2cccnc2-c2ncc[nH]2)cc2c(=O)n(COCC[Si](C)(C)C)cnc12 |
| InChI | InChI=1S/C28H39N5O4Si2/c1-38(2,3)14-12-35-19-33-18-32-25-23(28(33)34)16-21(17-24(25)37-20-36-13-15-39(4,5)6)22-8-7-9-29-26(22)27-30-10-11-31-27/h7-11,16-18H,12-15,19-20H2,1-6H3,(H,30,31) |
| InChIKey | JZMKLRQMSKKICQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.82 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|