C24H28N6O5Si — CID 160908315
2-(2-nitrophenyl)-1H-imidazole;trimethyl-[2-[[2-(2-nitrophenyl)imidazol-1-yl]methoxy]ethyl]silane (PubChem CID 160908315) has the molecular formula C24H28N6O5Si and a molecular weight of 508.61 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-1H-imidazole;trimethyl-[2-[[2-(2-nitrophenyl)imidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | 2-(2-nitrophenyl)-1H-imidazole;trimethyl-[2-[[2-(2-nitrophenyl)imidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 160908315 |
| Molecular Formula | C24H28N6O5Si |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 2-(2-nitrophenyl)-1H-imidazole;trimethyl-[2-[[2-(2-nitrophenyl)imidazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ccnc1-c1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1-c1ncc[nH]1 |
| InChI | InChI=1S/C15H21N3O3Si.C9H7N3O2/c1-22(2,3)11-10-21-12-17-9-8-16-15(17)13-6-4-5-7-14(13)18(19)20;13-12(14)8-4-2-1-3-7(8)9-10-5-6-11-9/h4-9H,10-12H2,1-3H3;1-6H,(H,10,11) |
| InChIKey | SQLAEACWKSBCEX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 142.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|