C21H32N4O3Si — CID 156726733
trimethyl-[2-[[4-methyl-5-[1-(2-nitrophenyl)piperidin-4-yl]imidazol-1-yl]methoxy]ethyl]silane (PubChem CID 156726733) has the molecular formula C21H32N4O3Si and a molecular weight of 416.60 g/mol. Its IUPAC name is trimethyl-[2-[[4-methyl-5-[1-(2-nitrophenyl)piperidin-4-yl]imidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-methyl-5-[1-(2-nitrophenyl)piperidin-4-yl]imidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 156726733 |
| Molecular Formula | C21H32N4O3Si |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | trimethyl-[2-[[4-methyl-5-[1-(2-nitrophenyl)piperidin-4-yl]imidazol-1-yl]methoxy]ethyl]silane |
| SMILES | Cc1ncn(COCC[Si](C)(C)C)c1C1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H32N4O3Si/c1-17-21(24(15-22-17)16-28-13-14-29(2,3)4)18-9-11-23(12-10-18)19-7-5-6-8-20(19)25(26)27/h5-8,15,18H,9-14,16H2,1-4H3 |
| InChIKey | FJBOKUVNMDHSNO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|