C30H43FN4OSi — CID 156726746
2-[4-(4-fluoro-3-methylphenyl)-3-[4-[5-methyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]piperidin-1-yl]phenyl]ethanamine (PubChem CID 156726746) has the molecular formula C30H43FN4OSi and a molecular weight of 522.79 g/mol. Its IUPAC name is 2-[4-(4-fluoro-3-methylphenyl)-3-[4-[5-methyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]piperidin-1-yl]phenyl]ethanamine.
| Compound Name | 2-[4-(4-fluoro-3-methylphenyl)-3-[4-[5-methyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]piperidin-1-yl]phenyl]ethanamine |
|---|---|
| PubChem CID | 156726746 |
| Molecular Formula | C30H43FN4OSi |
| Molecular Weight | 522.79 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | 2-[4-(4-fluoro-3-methylphenyl)-3-[4-[5-methyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]piperidin-1-yl]phenyl]ethanamine |
| SMILES | Cc1cc(-c2ccc(CCN)cc2N2CCC(c3c(C)ncn3COCC[Si](C)(C)C)CC2)ccc1F |
| InChI | InChI=1S/C30H43FN4OSi/c1-22-18-26(7-9-28(22)31)27-8-6-24(10-13-32)19-29(27)34-14-11-25(12-15-34)30-23(2)33-20-35(30)21-36-16-17-37(3,4)5/h6-9,18-20,25H,10-17,21,32H2,1-5H3 |
| InChIKey | YMHDRPLBDVQAGL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|