C18H24Cl2N2OSi — CID 164851760
2-[[5-cyclopropyl-4-(2,5-dichlorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 164851760) has the molecular formula C18H24Cl2N2OSi and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-[[5-cyclopropyl-4-(2,5-dichlorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-cyclopropyl-4-(2,5-dichlorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 164851760 |
| Molecular Formula | C18H24Cl2N2OSi |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-[[5-cyclopropyl-4-(2,5-dichlorophenyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cnc(-c2cc(Cl)ccc2Cl)c1C1CC1 |
| InChI | InChI=1S/C18H24Cl2N2OSi/c1-24(2,3)9-8-23-12-22-11-21-17(18(22)13-4-5-13)15-10-14(19)6-7-16(15)20/h6-7,10-11,13H,4-5,8-9,12H2,1-3H3 |
| InChIKey | SNLBOFBPVNLBRH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|