C21H29ClN2O4Si — CID 70496280
ethyl 3-(5-chloro-2-cyclopropyloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate (PubChem CID 70496280) has the molecular formula C21H29ClN2O4Si and a molecular weight of 437.01 g/mol. Its IUPAC name is ethyl 3-(5-chloro-2-cyclopropyloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 3-(5-chloro-2-cyclopropyloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 70496280 |
| Molecular Formula | C21H29ClN2O4Si |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | ethyl 3-(5-chloro-2-cyclopropyloxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(COCC[Si](C)(C)C)nc1-c1cc(Cl)ccc1OC1CC1 |
| InChI | InChI=1S/C21H29ClN2O4Si/c1-5-27-21(25)18-13-24(14-26-10-11-29(2,3)4)23-20(18)17-12-15(22)6-9-19(17)28-16-7-8-16/h6,9,12-13,16H,5,7-8,10-11,14H2,1-4H3 |
| InChIKey | KQGSMACAMVBUKS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|