C37H41N5O5S2Si — CID 159583963
ethyl 5-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrole-4-carboxylate;ethyl 3-(4-phenyl-1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate (PubChem CID 159583963) has the molecular formula C37H41N5O5S2Si and a molecular weight of 727.99 g/mol. Its IUPAC name is ethyl 5-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrole-4-carboxylate;ethyl 3-(4-phenyl-1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrole-4-carboxylate;ethyl 3-(4-phenyl-1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 159583963 |
| Molecular Formula | C37H41N5O5S2Si |
| Molecular Weight | 727.99 g/mol |
| Exact Mass | 727.23 |
| IUPAC Name | ethyl 5-(4-phenyl-1,3-thiazol-2-yl)-2H-pyrrole-4-carboxylate;ethyl 3-(4-phenyl-1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)C1=CCN=C1c1nc(-c2ccccc2)cs1.CCOC(=O)c1cn(COCC[Si](C)(C)C)nc1-c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H27N3O3SSi.C16H14N2O2S/c1-5-27-21(25)17-13-24(15-26-11-12-29(2,3)4)23-19(17)20-22-18(14-28-20)16-9-7-6-8-10-16;1-2-20-16(19)12-8-9-17-14(12)15-18-13(10-21-15)11-6-4-3-5-7-11/h6-10,13-14H,5,11-12,15H2,1-4H3;3-8,10H,2,9H2,1H3 |
| InChIKey | MJJKHPHCHRIMRF-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 117.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.99 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|