C26H24N2O5S2 — CID 161224499
ethyl 3-oxo-3-(4-phenyl-1,3-thiazol-2-yl)propanoate;ethyl 4-phenyl-1,3-thiazole-2-carboxylate (PubChem CID 161224499) has the molecular formula C26H24N2O5S2 and a molecular weight of 508.62 g/mol. Its IUPAC name is ethyl 3-oxo-3-(4-phenyl-1,3-thiazol-2-yl)propanoate;ethyl 4-phenyl-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 3-oxo-3-(4-phenyl-1,3-thiazol-2-yl)propanoate;ethyl 4-phenyl-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 161224499 |
| Molecular Formula | C26H24N2O5S2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | ethyl 3-oxo-3-(4-phenyl-1,3-thiazol-2-yl)propanoate;ethyl 4-phenyl-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)CC(=O)c1nc(-c2ccccc2)cs1.CCOC(=O)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C14H13NO3S.C12H11NO2S/c1-2-18-13(17)8-12(16)14-15-11(9-19-14)10-6-4-3-5-7-10;1-2-15-12(14)11-13-10(8-16-11)9-6-4-3-5-7-9/h3-7,9H,2,8H2,1H3;3-8H,2H2,1H3 |
| InChIKey | UXYDGODRHAWHQX-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|