C13H11NO4S — CID 175364501
ethyl 4-(3-formyl-4-hydroxyphenyl)-1,3-thiazole-2-carboxylate (PubChem CID 175364501) has the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. Its IUPAC name is ethyl 4-(3-formyl-4-hydroxyphenyl)-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 4-(3-formyl-4-hydroxyphenyl)-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 175364501 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | ethyl 4-(3-formyl-4-hydroxyphenyl)-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(O)c(C=O)c2)cs1 |
| InChI | InChI=1S/C13H11NO4S/c1-2-18-13(17)12-14-10(7-19-12)8-3-4-11(16)9(5-8)6-15/h3-7,16H,2H2,1H3 |
| InChIKey | UBFHRBHTEHNDQA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|