C11H11BrN2O2S — CID 71756591
ethyl 4-pyridin-3-yl-1,3-thiazole-2-carboxylate;hydrobromide (PubChem CID 71756591) has the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. Its IUPAC name is ethyl 4-pyridin-3-yl-1,3-thiazole-2-carboxylate;hydrobromide.
| Compound Name | ethyl 4-pyridin-3-yl-1,3-thiazole-2-carboxylate;hydrobromide |
|---|---|
| PubChem CID | 71756591 |
| Molecular Formula | C11H11BrN2O2S |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | ethyl 4-pyridin-3-yl-1,3-thiazole-2-carboxylate;hydrobromide |
| SMILES | Br.CCOC(=O)c1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C11H10N2O2S.BrH/c1-2-15-11(14)10-13-9(7-16-10)8-4-3-5-12-6-8;/h3-7H,2H2,1H3;1H |
| InChIKey | FYBZUZDXWJRXDR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |