C10H10N4O2 — CID 63381274
ethyl 3-pyridin-3-yl-1H-1,2,4-triazole-5-carboxylate (PubChem CID 63381274) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is ethyl 3-pyridin-3-yl-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 3-pyridin-3-yl-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 63381274 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | ethyl 3-pyridin-3-yl-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cccnc2)n[nH]1 |
| InChI | InChI=1S/C10H10N4O2/c1-2-16-10(15)9-12-8(13-14-9)7-4-3-5-11-6-7/h3-6H,2H2,1H3,(H,12,13,14) |
| InChIKey | YYBZOGZYIMDIRE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |