C11H10Cl2N4O2 — CID 82832838
ethyl 3-(4-amino-3,5-dichlorophenyl)-1H-1,2,4-triazole-5-carboxylate (PubChem CID 82832838) has the molecular formula C11H10Cl2N4O2 and a molecular weight of 301.13 g/mol. Its IUPAC name is ethyl 3-(4-amino-3,5-dichlorophenyl)-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 3-(4-amino-3,5-dichlorophenyl)-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 82832838 |
| Molecular Formula | C11H10Cl2N4O2 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | ethyl 3-(4-amino-3,5-dichlorophenyl)-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cc(Cl)c(N)c(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C11H10Cl2N4O2/c1-2-19-11(18)10-15-9(16-17-10)5-3-6(12)8(14)7(13)4-5/h3-4H,2,14H2,1H3,(H,15,16,17) |
| InChIKey | ZGJKYNDNJVCCAZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|