C11H9BrClN3O2 — CID 107940940
ethyl 3-(3-bromo-5-chlorophenyl)-1H-1,2,4-triazole-5-carboxylate (PubChem CID 107940940) has the molecular formula C11H9BrClN3O2 and a molecular weight of 330.57 g/mol. Its IUPAC name is ethyl 3-(3-bromo-5-chlorophenyl)-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 3-(3-bromo-5-chlorophenyl)-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 107940940 |
| Molecular Formula | C11H9BrClN3O2 |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | ethyl 3-(3-bromo-5-chlorophenyl)-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cc(Cl)cc(Br)c2)n[nH]1 |
| InChI | InChI=1S/C11H9BrClN3O2/c1-2-18-11(17)10-14-9(15-16-10)6-3-7(12)5-8(13)4-6/h3-5H,2H2,1H3,(H,14,15,16) |
| InChIKey | FDTOZNSMNMDYNW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |