C11H9F2N3O2 — CID 63381416
ethyl 3-(2,5-difluorophenyl)-1H-1,2,4-triazole-5-carboxylate (PubChem CID 63381416) has the molecular formula C11H9F2N3O2 and a molecular weight of 253.21 g/mol. Its IUPAC name is ethyl 3-(2,5-difluorophenyl)-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 3-(2,5-difluorophenyl)-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 63381416 |
| Molecular Formula | C11H9F2N3O2 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | ethyl 3-(2,5-difluorophenyl)-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cc(F)ccc2F)n[nH]1 |
| InChI | InChI=1S/C11H9F2N3O2/c1-2-18-11(17)10-14-9(15-16-10)7-5-6(12)3-4-8(7)13/h3-5H,2H2,1H3,(H,14,15,16) |
| InChIKey | VNSCGXHZQOYKGW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |