C13H15N3O4 — CID 63381738
ethyl 3-(2,5-dimethoxyphenyl)-1H-1,2,4-triazole-5-carboxylate (PubChem CID 63381738) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is ethyl 3-(2,5-dimethoxyphenyl)-1H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 3-(2,5-dimethoxyphenyl)-1H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 63381738 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | ethyl 3-(2,5-dimethoxyphenyl)-1H-1,2,4-triazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cc(OC)ccc2OC)n[nH]1 |
| InChI | InChI=1S/C13H15N3O4/c1-4-20-13(17)12-14-11(15-16-12)9-7-8(18-2)5-6-10(9)19-3/h5-7H,4H2,1-3H3,(H,14,15,16) |
| InChIKey | RHSYUIQZJCTERY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |