C14H15NO5 — CID 154791670
ethyl 5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxylate (PubChem CID 154791670) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is ethyl 5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 154791670 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | ethyl 5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cc(OC)ccc2OC)on1 |
| InChI | InChI=1S/C14H15NO5/c1-4-19-14(16)11-8-13(20-15-11)10-7-9(17-2)5-6-12(10)18-3/h5-8H,4H2,1-3H3 |
| InChIKey | SSSKTEHKBRUMKG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |