C13H13NO4 — CID 53439047
ethyl 5-(3-methoxyphenyl)-1,2-oxazole-3-carboxylate (PubChem CID 53439047) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl 5-(3-methoxyphenyl)-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-(3-methoxyphenyl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 53439047 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | ethyl 5-(3-methoxyphenyl)-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(OC)c2)on1 |
| InChI | InChI=1S/C13H13NO4/c1-3-17-13(15)11-8-12(18-14-11)9-5-4-6-10(7-9)16-2/h4-8H,3H2,1-2H3 |
| InChIKey | IYVNNFAVPARPGW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |