C15H16N2O3 — CID 22427421
[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-pyrrolidin-1-ylmethanone (PubChem CID 22427421) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is [5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 22427421 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | [5-(3-methoxyphenyl)-1,2-oxazol-3-yl]-pyrrolidin-1-ylmethanone |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCCC3)no2)c1 |
| InChI | InChI=1S/C15H16N2O3/c1-19-12-6-4-5-11(9-12)14-10-13(16-20-14)15(18)17-7-2-3-8-17/h4-6,9-10H,2-3,7-8H2,1H3 |
| InChIKey | GVXRIJQZTCVOLW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |