C21H22N2O2 — CID 46087244
azocan-1-yl-(5-naphthalen-2-yl-1,2-oxazol-3-yl)methanone (PubChem CID 46087244) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is azocan-1-yl-(5-naphthalen-2-yl-1,2-oxazol-3-yl)methanone.
| Compound Name | azocan-1-yl-(5-naphthalen-2-yl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 46087244 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | azocan-1-yl-(5-naphthalen-2-yl-1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1cc(-c2ccc3ccccc3c2)on1)N1CCCCCCC1 |
| InChI | InChI=1S/C21H22N2O2/c24-21(23-12-6-2-1-3-7-13-23)19-15-20(25-22-19)18-11-10-16-8-4-5-9-17(16)14-18/h4-5,8-11,14-15H,1-3,6-7,12-13H2 |
| InChIKey | TUGSZEBAYFAIHJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |