C16H18N2O3 — CID 135573124
azepan-1-yl-[5-(4-hydroxyphenyl)-1,2-oxazol-3-yl]methanone (PubChem CID 135573124) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is azepan-1-yl-[5-(4-hydroxyphenyl)-1,2-oxazol-3-yl]methanone.
| Compound Name | azepan-1-yl-[5-(4-hydroxyphenyl)-1,2-oxazol-3-yl]methanone |
|---|---|
| PubChem CID | 135573124 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | azepan-1-yl-[5-(4-hydroxyphenyl)-1,2-oxazol-3-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc(O)cc2)on1)N1CCCCCC1 |
| InChI | InChI=1S/C16H18N2O3/c19-13-7-5-12(6-8-13)15-11-14(17-21-15)16(20)18-9-3-1-2-4-10-18/h5-8,11,19H,1-4,9-10H2 |
| InChIKey | SQJHYMJAHNXYAM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |