C21H21N3O3 — CID 17011323
[4-(4-methoxyphenyl)piperazin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone (PubChem CID 17011323) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperazin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone.
| Compound Name | [4-(4-methoxyphenyl)piperazin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 17011323 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc(-c4ccccc4)on3)CC2)cc1 |
| InChI | InChI=1S/C21H21N3O3/c1-26-18-9-7-17(8-10-18)23-11-13-24(14-12-23)21(25)19-15-20(27-22-19)16-5-3-2-4-6-16/h2-10,15H,11-14H2,1H3 |
| InChIKey | VZMLAVVBQLVNHD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|