C25H23N3O3 — CID 9265987
[4-(4-methoxyphenyl)piperazin-1-yl]-(3-phenyl-2,1-benzoxazol-5-yl)methanone (PubChem CID 9265987) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperazin-1-yl]-(3-phenyl-2,1-benzoxazol-5-yl)methanone.
| Compound Name | [4-(4-methoxyphenyl)piperazin-1-yl]-(3-phenyl-2,1-benzoxazol-5-yl)methanone |
|---|---|
| PubChem CID | 9265987 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-(3-phenyl-2,1-benzoxazol-5-yl)methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc4noc(-c5ccccc5)c4c3)CC2)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-30-21-10-8-20(9-11-21)27-13-15-28(16-14-27)25(29)19-7-12-23-22(17-19)24(31-26-23)18-5-3-2-4-6-18/h2-12,17H,13-16H2,1H3 |
| InChIKey | RPYTWGPKBMTYQC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|