C29H28FN3O3 — CID 46319075
[4-ethoxy-2-(4-fluorophenyl)quinolin-6-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 46319075) has the molecular formula C29H28FN3O3 and a molecular weight of 485.56 g/mol. Its IUPAC name is [4-ethoxy-2-(4-fluorophenyl)quinolin-6-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [4-ethoxy-2-(4-fluorophenyl)quinolin-6-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46319075 |
| Molecular Formula | C29H28FN3O3 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | [4-ethoxy-2-(4-fluorophenyl)quinolin-6-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCOc1cc(-c2ccc(F)cc2)nc2ccc(C(=O)N3CCN(c4ccc(OC)cc4)CC3)cc12 |
| InChI | InChI=1S/C29H28FN3O3/c1-3-36-28-19-27(20-4-7-22(30)8-5-20)31-26-13-6-21(18-25(26)28)29(34)33-16-14-32(15-17-33)23-9-11-24(35-2)12-10-23/h4-13,18-19H,3,14-17H2,1-2H3 |
| InChIKey | UQOKDYFQLJWIFJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|