C24H19FN2O3 — CID 46319037
4-ethoxy-2-(4-fluorophenyl)-N-(2-hydroxyphenyl)quinoline-6-carboxamide (PubChem CID 46319037) has the molecular formula C24H19FN2O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is 4-ethoxy-2-(4-fluorophenyl)-N-(2-hydroxyphenyl)quinoline-6-carboxamide.
| Compound Name | 4-ethoxy-2-(4-fluorophenyl)-N-(2-hydroxyphenyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 46319037 |
| Molecular Formula | C24H19FN2O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 4-ethoxy-2-(4-fluorophenyl)-N-(2-hydroxyphenyl)quinoline-6-carboxamide |
| SMILES | CCOc1cc(-c2ccc(F)cc2)nc2ccc(C(=O)Nc3ccccc3O)cc12 |
| InChI | InChI=1S/C24H19FN2O3/c1-2-30-23-14-21(15-7-10-17(25)11-8-15)26-19-12-9-16(13-18(19)23)24(29)27-20-5-3-4-6-22(20)28/h3-14,28H,2H2,1H3,(H,27,29) |
| InChIKey | KZEQWXFRPDUBJB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|