C26H27FN2O4 — CID 46319079
ethyl 1-[4-ethoxy-2-(4-fluorophenyl)quinoline-6-carbonyl]piperidine-4-carboxylate (PubChem CID 46319079) has the molecular formula C26H27FN2O4 and a molecular weight of 450.51 g/mol. Its IUPAC name is ethyl 1-[4-ethoxy-2-(4-fluorophenyl)quinoline-6-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-ethoxy-2-(4-fluorophenyl)quinoline-6-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46319079 |
| Molecular Formula | C26H27FN2O4 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | ethyl 1-[4-ethoxy-2-(4-fluorophenyl)quinoline-6-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc3nc(-c4ccc(F)cc4)cc(OCC)c3c2)CC1 |
| InChI | InChI=1S/C26H27FN2O4/c1-3-32-24-16-23(17-5-8-20(27)9-6-17)28-22-10-7-19(15-21(22)24)25(30)29-13-11-18(12-14-29)26(31)33-4-2/h5-10,15-16,18H,3-4,11-14H2,1-2H3 |
| InChIKey | JXVLIDKIQDGUCX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |