C21H22N2O2 — CID 92761255
[(2R)-2-ethylpiperidin-1-yl]-(5-naphthalen-2-yl-1,2-oxazol-3-yl)methanone (PubChem CID 92761255) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is [(2R)-2-ethylpiperidin-1-yl]-(5-naphthalen-2-yl-1,2-oxazol-3-yl)methanone.
| Compound Name | [(2R)-2-ethylpiperidin-1-yl]-(5-naphthalen-2-yl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 92761255 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | [(2R)-2-ethylpiperidin-1-yl]-(5-naphthalen-2-yl-1,2-oxazol-3-yl)methanone |
| SMILES | CC[C@@H]1CCCCN1C(=O)c1cc(-c2ccc3ccccc3c2)on1 |
| InChI | InChI=1S/C21H22N2O2/c1-2-18-9-5-6-12-23(18)21(24)19-14-20(25-22-19)17-11-10-15-7-3-4-8-16(15)13-17/h3-4,7-8,10-11,13-14,18H,2,5-6,9,12H2,1H3/t18-/m1/s1 |
| InChIKey | QTFAXZDXFLVEAR-GOSISDBHSA-N |
| XLogP | 4.90 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |