C16H18N2O2 — CID 3158156
(2-methylpiperidin-1-yl)-(5-phenyl-1,2-oxazol-3-yl)methanone (PubChem CID 3158156) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (2-methylpiperidin-1-yl)-(5-phenyl-1,2-oxazol-3-yl)methanone.
| Compound Name | (2-methylpiperidin-1-yl)-(5-phenyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 3158156 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (2-methylpiperidin-1-yl)-(5-phenyl-1,2-oxazol-3-yl)methanone |
| SMILES | CC1CCCCN1C(=O)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H18N2O2/c1-12-7-5-6-10-18(12)16(19)14-11-15(20-17-14)13-8-3-2-4-9-13/h2-4,8-9,11-12H,5-7,10H2,1H3 |
| InChIKey | NSLWTPGSAPJACL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |