C12H16N2O4 — CID 107369689
3-(2-methylazepane-1-carbonyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 107369689) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-(2-methylazepane-1-carbonyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(2-methylazepane-1-carbonyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107369689 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-(2-methylazepane-1-carbonyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | CC1CCCCCN1C(=O)c1cc(C(=O)O)on1 |
| InChI | InChI=1S/C12H16N2O4/c1-8-5-3-2-4-6-14(8)11(15)9-7-10(12(16)17)18-13-9/h7-8H,2-6H2,1H3,(H,16,17) |
| InChIKey | IABFXWQDELFUNE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |