About [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone
[5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone (PubChem CID 5128006) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone |
| PubChem CID | 5128006 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone |
| SMILES | COc1ccccc1-c1cc(C(=O)N2CCCCC2C)no1 |
| InChI | InChI=1S/C17H20N2O3/c1-12-7-5-6-10-19(12)17(20)14-11-16(22-18-14)13-8-3-4-9-15(13)21-2/h3-4,8-9,11-12H,5-7,10H2,1-2H3 |
| InChIKey | LIPQKHNFAVRWAY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone?
The IUPAC name of [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone (CID 5128006) is [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone.
What is the SMILES notation for [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone?
The canonical SMILES for [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone is COc1ccccc1-c1cc(C(=O)N2CCCCC2C)no1.
What is the InChIKey of [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone?
The InChIKey is LIPQKHNFAVRWAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O3/c1-12-7-5-6-10-19(12)17(20)14-11-16(22-18-14)13-8-3-4-9-15(13)21-2/h3-4,8-9,11-12H,5-7,10H2,1-2H3.
What are the key properties of [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone?
[5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone has a molecular weight of 300.36 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-methoxyphenyl)-1,2-oxazol-3-yl]-(2-methylpiperidin-1-yl)methanone is sourced from PubChem (CID 5128006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).