About 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid
3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 107370020) has the molecular formula C11H14N2O4S
and a molecular weight of 270.31 g/mol. Its IUPAC name is 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 107370020 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | CC1SCCN(C(=O)c2cc(C(=O)O)on2)C1C |
| InChI | InChI=1S/C11H14N2O4S/c1-6-7(2)18-4-3-13(6)10(14)8-5-9(11(15)16)17-12-8/h5-7H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | KJSSXFIDLASLQE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid (CID 107370020) is 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid is CC1SCCN(C(=O)c2cc(C(=O)O)on2)C1C.
What is the InChIKey of 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid?
The InChIKey is KJSSXFIDLASLQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4S/c1-6-7(2)18-4-3-13(6)10(14)8-5-9(11(15)16)17-12-8/h5-7H,3-4H2,1-2H3,(H,15,16).
What are the key properties of 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid?
3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid has a molecular weight of 270.31 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylthiomorpholine-4-carbonyl)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 107370020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).